C7H7NO4S — CID 66714979
2-ethoxycarbonyl-1,3-thiazole-5-carboxylic acid (PubChem CID 66714979) has the molecular formula C7H7NO4S and a molecular weight of 201.20 g/mol. Its IUPAC name is 2-ethoxycarbonyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-ethoxycarbonyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 66714979 |
| Molecular Formula | C7H7NO4S |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | 2-ethoxycarbonyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CCOC(=O)c1ncc(C(=O)O)s1 |
| InChI | InChI=1S/C7H7NO4S/c1-2-12-7(11)5-8-3-4(13-5)6(9)10/h3H,2H2,1H3,(H,9,10) |
| InChIKey | QJFUSYNFWLGJIO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |