C9H14N2O3S — CID 80571694
2-(3-ethoxypropylamino)-1,3-thiazole-5-carboxylic acid (PubChem CID 80571694) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 2-(3-ethoxypropylamino)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(3-ethoxypropylamino)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 80571694 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-(3-ethoxypropylamino)-1,3-thiazole-5-carboxylic acid |
| SMILES | CCOCCCNc1ncc(C(=O)O)s1 |
| InChI | InChI=1S/C9H14N2O3S/c1-2-14-5-3-4-10-9-11-6-7(15-9)8(12)13/h6H,2-5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | MNPMDHWNOYJIBX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|