C10H16N2O3S — CID 115423281
2-(3-ethoxypropylamino)-5-methyl-1,3-thiazole-4-carboxylic acid (PubChem CID 115423281) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-(3-ethoxypropylamino)-5-methyl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(3-ethoxypropylamino)-5-methyl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115423281 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-(3-ethoxypropylamino)-5-methyl-1,3-thiazole-4-carboxylic acid |
| SMILES | CCOCCCNc1nc(C(=O)O)c(C)s1 |
| InChI | InChI=1S/C10H16N2O3S/c1-3-15-6-4-5-11-10-12-8(9(13)14)7(2)16-10/h3-6H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | KVDZBVHMYJFWRY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|