C8H10N2O2S — CID 130569093
2-(2-methylprop-2-enylamino)-1,3-thiazole-5-carboxylic acid (PubChem CID 130569093) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is 2-(2-methylprop-2-enylamino)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(2-methylprop-2-enylamino)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 130569093 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2-(2-methylprop-2-enylamino)-1,3-thiazole-5-carboxylic acid |
| SMILES | C=C(C)CNc1ncc(C(=O)O)s1 |
| InChI | InChI=1S/C8H10N2O2S/c1-5(2)3-9-8-10-4-6(13-8)7(11)12/h4H,1,3H2,2H3,(H,9,10)(H,11,12) |
| InChIKey | WXKNEBCOSQSDTB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|