C11H20N2O3S — CID 143328357
2-[(5-acetyl-1,3-thiazol-2-yl)amino]acetic acid;ethane (PubChem CID 143328357) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-[(5-acetyl-1,3-thiazol-2-yl)amino]acetic acid;ethane.
| Compound Name | 2-[(5-acetyl-1,3-thiazol-2-yl)amino]acetic acid;ethane |
|---|---|
| PubChem CID | 143328357 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-[(5-acetyl-1,3-thiazol-2-yl)amino]acetic acid;ethane |
| SMILES | CC.CC.CC(=O)c1cnc(NCC(=O)O)s1 |
| InChI | InChI=1S/C7H8N2O3S.2C2H6/c1-4(10)5-2-8-7(13-5)9-3-6(11)12;2*1-2/h2H,3H2,1H3,(H,8,9)(H,11,12);2*1-2H3 |
| InChIKey | WFJKCSXWPLKIPW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |