C10H15N3O2S — CID 119329732
(2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-amino-3-methylbutanamide (PubChem CID 119329732) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-amino-3-methylbutanamide.
| Compound Name | (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-amino-3-methylbutanamide |
|---|---|
| PubChem CID | 119329732 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-amino-3-methylbutanamide |
| SMILES | CC(=O)c1cnc(NC(=O)[C@@H](N)C(C)C)s1 |
| InChI | InChI=1S/C10H15N3O2S/c1-5(2)8(11)9(15)13-10-12-4-7(16-10)6(3)14/h4-5,8H,11H2,1-3H3,(H,12,13,15)/t8-/m0/s1 |
| InChIKey | LQLXETMCNXSVPI-QMMMGPOBSA-N |
| XLogP | 1.27 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |