C8H12N2OS — CID 58688654
1-[2-(propylamino)-1,3-thiazol-5-yl]ethanone (PubChem CID 58688654) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is 1-[2-(propylamino)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(propylamino)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 58688654 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-[2-(propylamino)-1,3-thiazol-5-yl]ethanone |
| SMILES | CCCNc1ncc(C(C)=O)s1 |
| InChI | InChI=1S/C8H12N2OS/c1-3-4-9-8-10-5-7(12-8)6(2)11/h5H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | BCPWWCIVYFTYTN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |