About N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid
N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid (PubChem CID 58334936) has the molecular formula C6H9BN2O2S
and a molecular weight of 184.03 g/mol. Its IUPAC name is N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid.
Molecular Properties
| Compound Name | N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid |
| PubChem CID | 58334936 |
| Molecular Formula | C6H9BN2O2S |
| Molecular Weight | 184.03 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid |
| SMILES | CB(O)Nc1ncc(C(C)=O)s1 |
| InChI | InChI=1S/C6H9BN2O2S/c1-4(10)5-3-8-6(12-5)9-7(2)11/h3,11H,1-2H3,(H,8,9) |
| InChIKey | BWWWKSQSJZFKQP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.03 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid?
The IUPAC name of N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid (CID 58334936) is N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid.
What is the SMILES notation for N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid?
The canonical SMILES for N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid is CB(O)Nc1ncc(C(C)=O)s1.
What is the InChIKey of N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid?
The InChIKey is BWWWKSQSJZFKQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BN2O2S/c1-4(10)5-3-8-6(12-5)9-7(2)11/h3,11H,1-2H3,(H,8,9).
What are the key properties of N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid?
N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid has a molecular weight of 184.03 g/mol, XLogP of 0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid is sourced from PubChem (CID 58334936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).