C6H9BN2O2S — CID 58334936
N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid (PubChem CID 58334936) has the molecular formula C6H9BN2O2S and a molecular weight of 184.03 g/mol. Its IUPAC name is N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid.
| Compound Name | N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid |
|---|---|
| PubChem CID | 58334936 |
| Molecular Formula | C6H9BN2O2S |
| Molecular Weight | 184.03 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | N-(5-acetyl-1,3-thiazol-2-yl)-methylboronamidic acid |
| SMILES | CB(O)Nc1ncc(C(C)=O)s1 |
| InChI | InChI=1S/C6H9BN2O2S/c1-4(10)5-3-8-6(12-5)9-7(2)11/h3,11H,1-2H3,(H,8,9) |
| InChIKey | BWWWKSQSJZFKQP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.03 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|