2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid

C6H6F2N2O2S — CID 115409393

IUPAC2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(NCC(F)F)s1
InChIInChI=1S/C6H6F2N2O2S/c7-4(8)2-10-6-9-1-3(13-6)5(11)12/h1,4H,2H2,(H,9,10)(H,11,12)
InChIKeyCGNBZEQBIYEYCC-UHFFFAOYSA-N
MW208.19 g/mol
LogP1.52
Rot. Bonds4

About 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid

2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid (PubChem CID 115409393) has the molecular formula C6H6F2N2O2S and a molecular weight of 208.19 g/mol. Its IUPAC name is 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid
PubChem CID115409393
Molecular FormulaC6H6F2N2O2S
Molecular Weight208.19 g/mol
Exact Mass208.01
IUPAC Name2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(NCC(F)F)s1
InChIInChI=1S/C6H6F2N2O2S/c7-4(8)2-10-6-9-1-3(13-6)5(11)12/h1,4H,2H2,(H,9,10)(H,11,12)
InChIKeyCGNBZEQBIYEYCC-UHFFFAOYSA-N
XLogP1.52
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.19
LogP ≤ 51.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid (CID 115409393) is 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(NCC(F)F)s1.
What is the InChIKey of 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid?
The InChIKey is CGNBZEQBIYEYCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F2N2O2S/c7-4(8)2-10-6-9-1-3(13-6)5(11)12/h1,4H,2H2,(H,9,10)(H,11,12).
What are the key properties of 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid?
2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid has a molecular weight of 208.19 g/mol, XLogP of 1.52, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 115409393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).