C6H6F2N2O2S — CID 115409393
2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid (PubChem CID 115409393) has the molecular formula C6H6F2N2O2S and a molecular weight of 208.19 g/mol. Its IUPAC name is 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 115409393 |
| Molecular Formula | C6H6F2N2O2S |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCC(F)F)s1 |
| InChI | InChI=1S/C6H6F2N2O2S/c7-4(8)2-10-6-9-1-3(13-6)5(11)12/h1,4H,2H2,(H,9,10)(H,11,12) |
| InChIKey | CGNBZEQBIYEYCC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |