C32H40F2O4S2 — CID 158835848
diethyl 2,5-difluoro-3,6-bis(5-hexylthiophen-2-yl)benzene-1,4-dicarboxylate (PubChem CID 158835848) has the molecular formula C32H40F2O4S2 and a molecular weight of 590.80 g/mol. Its IUPAC name is diethyl 2,5-difluoro-3,6-bis(5-hexylthiophen-2-yl)benzene-1,4-dicarboxylate.
| Compound Name | diethyl 2,5-difluoro-3,6-bis(5-hexylthiophen-2-yl)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 158835848 |
| Molecular Formula | C32H40F2O4S2 |
| Molecular Weight | 590.80 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | diethyl 2,5-difluoro-3,6-bis(5-hexylthiophen-2-yl)benzene-1,4-dicarboxylate |
| SMILES | CCCCCCc1ccc(-c2c(F)c(C(=O)OCC)c(-c3ccc(CCCCCC)s3)c(F)c2C(=O)OCC)s1 |
| InChI | InChI=1S/C32H40F2O4S2/c1-5-9-11-13-15-21-17-19-23(39-21)25-27(31(35)37-7-3)30(34)26(28(29(25)33)32(36)38-8-4)24-20-18-22(40-24)16-14-12-10-6-2/h17-20H,5-16H2,1-4H3 |
| InChIKey | IXPXFWHFESBBML-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.80 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|