C30H36OS5 — CID 101498885
S-[6-[5-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]hexyl] ethanethioate (PubChem CID 101498885) has the molecular formula C30H36OS5 and a molecular weight of 572.95 g/mol. Its IUPAC name is S-[6-[5-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]hexyl] ethanethioate.
| Compound Name | S-[6-[5-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]hexyl] ethanethioate |
|---|---|
| PubChem CID | 101498885 |
| Molecular Formula | C30H36OS5 |
| Molecular Weight | 572.95 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | S-[6-[5-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]hexyl] ethanethioate |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(CCCCCCSC(C)=O)s4)s3)s2)s1 |
| InChI | InChI=1S/C30H36OS5/c1-3-4-5-8-11-23-13-15-25(33-23)27-17-19-29(35-27)30-20-18-28(36-30)26-16-14-24(34-26)12-9-6-7-10-21-32-22(2)31/h13-20H,3-12,21H2,1-2H3 |
| InChIKey | MLDZXRVFQXFOHW-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.95 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|