C47H47NO2S4 — CID 101136994
5-[5-[4-[4-(5-hexylthiophen-2-yl)-N-[4-(5-hexylthiophen-2-yl)phenyl]anilino]phenyl]thiophen-2-yl]thiophene-2-carboxylic acid (PubChem CID 101136994) has the molecular formula C47H47NO2S4 and a molecular weight of 786.17 g/mol. Its IUPAC name is 5-[5-[4-[4-(5-hexylthiophen-2-yl)-N-[4-(5-hexylthiophen-2-yl)phenyl]anilino]phenyl]thiophen-2-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-[5-[4-[4-(5-hexylthiophen-2-yl)-N-[4-(5-hexylthiophen-2-yl)phenyl]anilino]phenyl]thiophen-2-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 101136994 |
| Molecular Formula | C47H47NO2S4 |
| Molecular Weight | 786.17 g/mol |
| Exact Mass | 785.25 |
| IUPAC Name | 5-[5-[4-[4-(5-hexylthiophen-2-yl)-N-[4-(5-hexylthiophen-2-yl)phenyl]anilino]phenyl]thiophen-2-yl]thiophene-2-carboxylic acid |
| SMILES | CCCCCCc1ccc(-c2ccc(N(c3ccc(-c4ccc(CCCCCC)s4)cc3)c3ccc(-c4ccc(-c5ccc(C(=O)O)s5)s4)cc3)cc2)s1 |
| InChI | InChI=1S/C47H47NO2S4/c1-3-5-7-9-11-39-25-27-41(51-39)33-13-19-36(20-14-33)48(37-21-15-34(16-22-37)42-28-26-40(52-42)12-10-8-6-4-2)38-23-17-35(18-24-38)43-29-30-44(53-43)45-31-32-46(54-45)47(49)50/h13-32H,3-12H2,1-2H3,(H,49,50) |
| InChIKey | DDBMGBPXXGOHHV-UHFFFAOYSA-N |
| XLogP | 16.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.17 |
| LogP ≤ 5 | 16.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|