C28H34O4S2 — CID 67094583
2,5-bis(5-hexylthiophen-2-yl)terephthalic acid (PubChem CID 67094583) has the molecular formula C28H34O4S2 and a molecular weight of 498.71 g/mol. Its IUPAC name is 2,5-bis(5-hexylthiophen-2-yl)terephthalic acid.
| Compound Name | 2,5-bis(5-hexylthiophen-2-yl)terephthalic acid |
|---|---|
| PubChem CID | 67094583 |
| Molecular Formula | C28H34O4S2 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 2,5-bis(5-hexylthiophen-2-yl)terephthalic acid |
| SMILES | CCCCCCc1ccc(-c2cc(C(=O)O)c(-c3ccc(CCCCCC)s3)cc2C(=O)O)s1 |
| InChI | InChI=1S/C28H34O4S2/c1-3-5-7-9-11-19-13-15-25(33-19)21-17-24(28(31)32)22(18-23(21)27(29)30)26-16-14-20(34-26)12-10-8-6-4-2/h13-18H,3-12H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | UENVQAIUHJVFGI-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|