2,5-bis(5-hexylthiophen-2-yl)terephthalic acid

C28H34O4S2 — CID 67094583

IUPAC2,5-bis(5-hexylthiophen-2-yl)terephthalic acid
SMILESCCCCCCc1ccc(-c2cc(C(=O)O)c(-c3ccc(CCCCCC)s3)cc2C(=O)O)s1
InChIInChI=1S/C28H34O4S2/c1-3-5-7-9-11-19-13-15-25(33-19)21-17-24(28(31)32)22(18-23(21)27(29)30)26-16-14-20(34-26)12-10-8-6-4-2/h13-18H,3-12H2,1-2H3,(H,29,30)(H,31,32)
InChIKeyUENVQAIUHJVFGI-UHFFFAOYSA-N
MW498.71 g/mol
LogP8.79
Rot. Bonds14

About 2,5-bis(5-hexylthiophen-2-yl)terephthalic acid

2,5-bis(5-hexylthiophen-2-yl)terephthalic acid (PubChem CID 67094583) has the molecular formula C28H34O4S2 and a molecular weight of 498.71 g/mol. Its IUPAC name is 2,5-bis(5-hexylthiophen-2-yl)terephthalic acid.

Molecular Properties

Compound Name2,5-bis(5-hexylthiophen-2-yl)terephthalic acid
PubChem CID67094583
Molecular FormulaC28H34O4S2
Molecular Weight498.71 g/mol
Exact Mass498.19
IUPAC Name2,5-bis(5-hexylthiophen-2-yl)terephthalic acid
SMILESCCCCCCc1ccc(-c2cc(C(=O)O)c(-c3ccc(CCCCCC)s3)cc2C(=O)O)s1
InChIInChI=1S/C28H34O4S2/c1-3-5-7-9-11-19-13-15-25(33-19)21-17-24(28(31)32)22(18-23(21)27(29)30)26-16-14-20(34-26)12-10-8-6-4-2/h13-18H,3-12H2,1-2H3,(H,29,30)(H,31,32)
InChIKeyUENVQAIUHJVFGI-UHFFFAOYSA-N
XLogP8.79
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds14
Heavy Atoms34
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500498.71
LogP ≤ 58.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2,5-bis(5-hexylthiophen-2-yl)terephthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-bis(5-hexylthiophen-2-yl)terephthalic acid?
The IUPAC name of 2,5-bis(5-hexylthiophen-2-yl)terephthalic acid (CID 67094583) is 2,5-bis(5-hexylthiophen-2-yl)terephthalic acid.
What is the SMILES notation for 2,5-bis(5-hexylthiophen-2-yl)terephthalic acid?
The canonical SMILES for 2,5-bis(5-hexylthiophen-2-yl)terephthalic acid is CCCCCCc1ccc(-c2cc(C(=O)O)c(-c3ccc(CCCCCC)s3)cc2C(=O)O)s1.
What is the InChIKey of 2,5-bis(5-hexylthiophen-2-yl)terephthalic acid?
The InChIKey is UENVQAIUHJVFGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34O4S2/c1-3-5-7-9-11-19-13-15-25(33-19)21-17-24(28(31)32)22(18-23(21)27(29)30)26-16-14-20(34-26)12-10-8-6-4-2/h13-18H,3-12H2,1-2H3,(H,29,30)(H,31,32).
What are the key properties of 2,5-bis(5-hexylthiophen-2-yl)terephthalic acid?
2,5-bis(5-hexylthiophen-2-yl)terephthalic acid has a molecular weight of 498.71 g/mol, XLogP of 8.79, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(5-hexylthiophen-2-yl)terephthalic acid is sourced from PubChem (CID 67094583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).