C30H38O4S2 — CID 67094697
dimethyl 2,5-bis(5-hexylthiophen-2-yl)benzene-1,4-dicarboxylate (PubChem CID 67094697) has the molecular formula C30H38O4S2 and a molecular weight of 526.76 g/mol. Its IUPAC name is dimethyl 2,5-bis(5-hexylthiophen-2-yl)benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2,5-bis(5-hexylthiophen-2-yl)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 67094697 |
| Molecular Formula | C30H38O4S2 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | dimethyl 2,5-bis(5-hexylthiophen-2-yl)benzene-1,4-dicarboxylate |
| SMILES | CCCCCCc1ccc(-c2cc(C(=O)OC)c(-c3ccc(CCCCCC)s3)cc2C(=O)OC)s1 |
| InChI | InChI=1S/C30H38O4S2/c1-5-7-9-11-13-21-15-17-27(35-21)23-19-26(30(32)34-4)24(20-25(23)29(31)33-3)28-18-16-22(36-28)14-12-10-8-6-2/h15-20H,5-14H2,1-4H3 |
| InChIKey | IIZYXDVUOFLRSF-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|