C39H46O4S4 — CID 89155123
methyl 2-[2,5-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-4-(methylperoxymethyl)phenyl]acetate (PubChem CID 89155123) has the molecular formula C39H46O4S4 and a molecular weight of 707.06 g/mol. Its IUPAC name is methyl 2-[2,5-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-4-(methylperoxymethyl)phenyl]acetate.
| Compound Name | methyl 2-[2,5-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-4-(methylperoxymethyl)phenyl]acetate |
|---|---|
| PubChem CID | 89155123 |
| Molecular Formula | C39H46O4S4 |
| Molecular Weight | 707.06 g/mol |
| Exact Mass | 706.23 |
| IUPAC Name | methyl 2-[2,5-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-4-(methylperoxymethyl)phenyl]acetate |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3cc(CC(=O)OC)c(-c4ccc(-c5ccc(CCCCCC)s5)s4)cc3COOC)s2)s1 |
| InChI | InChI=1S/C39H46O4S4/c1-5-7-9-11-13-29-15-17-35(44-29)37-21-19-33(46-37)31-24-28(26-43-42-4)32(23-27(31)25-39(40)41-3)34-20-22-38(47-34)36-18-16-30(45-36)14-12-10-8-6-2/h15-24H,5-14,25-26H2,1-4H3 |
| InChIKey | BGDMSSGMUYSODD-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.06 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|