C26H30F4S2 — CID 102511967
2-hexyl-5-[2,3,5,6-tetrafluoro-4-(5-hexylthiophen-2-yl)phenyl]thiophene (PubChem CID 102511967) has the molecular formula C26H30F4S2 and a molecular weight of 482.65 g/mol. Its IUPAC name is 2-hexyl-5-[2,3,5,6-tetrafluoro-4-(5-hexylthiophen-2-yl)phenyl]thiophene.
| Compound Name | 2-hexyl-5-[2,3,5,6-tetrafluoro-4-(5-hexylthiophen-2-yl)phenyl]thiophene |
|---|---|
| PubChem CID | 102511967 |
| Molecular Formula | C26H30F4S2 |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 2-hexyl-5-[2,3,5,6-tetrafluoro-4-(5-hexylthiophen-2-yl)phenyl]thiophene |
| SMILES | CCCCCCc1ccc(-c2c(F)c(F)c(-c3ccc(CCCCCC)s3)c(F)c2F)s1 |
| InChI | InChI=1S/C26H30F4S2/c1-3-5-7-9-11-17-13-15-19(31-17)21-23(27)25(29)22(26(30)24(21)28)20-16-14-18(32-20)12-10-8-6-4-2/h13-16H,3-12H2,1-2H3 |
| InChIKey | VJCAYSICFSZFAS-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|