C36H17Br2F11S2 — CID 45277317
2-[2-[4-[2-[3-bromo-4-(2-bromo-3,4,5,6-tetrafluorophenyl)-2,5,6-trifluorophenyl]ethynyl]-2,3,5,6-tetrafluorophenyl]ethynyl]-5-(5-hexylthiophen-2-yl)thiophene (PubChem CID 45277317) has the molecular formula C36H17Br2F11S2 and a molecular weight of 882.45 g/mol. Its IUPAC name is 2-[2-[4-[2-[3-bromo-4-(2-bromo-3,4,5,6-tetrafluorophenyl)-2,5,6-trifluorophenyl]ethynyl]-2,3,5,6-tetrafluorophenyl]ethynyl]-5-(5-hexylthiophen-2-yl)thiophene.
| Compound Name | 2-[2-[4-[2-[3-bromo-4-(2-bromo-3,4,5,6-tetrafluorophenyl)-2,5,6-trifluorophenyl]ethynyl]-2,3,5,6-tetrafluorophenyl]ethynyl]-5-(5-hexylthiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 45277317 |
| Molecular Formula | C36H17Br2F11S2 |
| Molecular Weight | 882.45 g/mol |
| Exact Mass | 879.90 |
| IUPAC Name | 2-[2-[4-[2-[3-bromo-4-(2-bromo-3,4,5,6-tetrafluorophenyl)-2,5,6-trifluorophenyl]ethynyl]-2,3,5,6-tetrafluorophenyl]ethynyl]-5-(5-hexylthiophen-2-yl)thiophene |
| SMILES | CCCCCCc1ccc(-c2ccc(C#Cc3c(F)c(F)c(C#Cc4c(F)c(F)c(-c5c(F)c(F)c(F)c(F)c5Br)c(Br)c4F)c(F)c3F)s2)s1 |
| InChI | InChI=1S/C36H17Br2F11S2/c1-2-3-4-5-6-15-8-13-20(50-15)21-14-9-16(51-21)7-10-18-27(40)29(42)19(30(43)28(18)41)12-11-17-26(39)24(37)22(32(45)31(17)44)23-25(38)34(47)36(49)35(48)33(23)46/h8-9,13-14H,2-6H2,1H3 |
| InChIKey | ALUBOTRDUDODLX-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.45 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|