C32H28S5 — CID 58825507
2,5-bis[5-[2-(5-butylthiophen-2-yl)ethynyl]thiophen-2-yl]thiophene (PubChem CID 58825507) has the molecular formula C32H28S5 and a molecular weight of 572.91 g/mol. Its IUPAC name is 2,5-bis[5-[2-(5-butylthiophen-2-yl)ethynyl]thiophen-2-yl]thiophene.
| Compound Name | 2,5-bis[5-[2-(5-butylthiophen-2-yl)ethynyl]thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 58825507 |
| Molecular Formula | C32H28S5 |
| Molecular Weight | 572.91 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | 2,5-bis[5-[2-(5-butylthiophen-2-yl)ethynyl]thiophen-2-yl]thiophene |
| SMILES | CCCCc1ccc(C#Cc2ccc(-c3ccc(-c4ccc(C#Cc5ccc(CCCC)s5)s4)s3)s2)s1 |
| InChI | InChI=1S/C32H28S5/c1-3-5-7-23-9-11-25(33-23)13-15-27-17-19-29(35-27)31-21-22-32(37-31)30-20-18-28(36-30)16-14-26-12-10-24(34-26)8-6-4-2/h9-12,17-22H,3-8H2,1-2H3 |
| InChIKey | YAKRWHWBPITOTL-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.91 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|