C17H14FNS2 — CID 178054290
2-butyl-5-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]thiophene (PubChem CID 178054290) has the molecular formula C17H14FNS2 and a molecular weight of 315.44 g/mol. Its IUPAC name is 2-butyl-5-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]thiophene.
| Compound Name | 2-butyl-5-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]thiophene |
|---|---|
| PubChem CID | 178054290 |
| Molecular Formula | C17H14FNS2 |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-butyl-5-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]thiophene |
| SMILES | CCCCc1ccc(C#Cc2ccc(N=C=S)c(F)c2)s1 |
| InChI | InChI=1S/C17H14FNS2/c1-2-3-4-14-8-9-15(21-14)7-5-13-6-10-17(19-12-20)16(18)11-13/h6,8-11H,2-4H2,1H3 |
| InChIKey | QZTQFVNXNSGZHD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|