C23H22FNS — CID 169279806
2-butyl-6-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 169279806) has the molecular formula C23H22FNS and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-butyl-6-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-butyl-6-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 169279806 |
| Molecular Formula | C23H22FNS |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2-butyl-6-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCC1CCc2cc(C#Cc3ccc(N=C=S)c(F)c3)ccc2C1 |
| InChI | InChI=1S/C23H22FNS/c1-2-3-4-17-7-10-21-14-18(8-11-20(21)13-17)5-6-19-9-12-23(25-16-26)22(24)15-19/h8-9,11-12,14-15,17H,2-4,7,10,13H2,1H3 |
| InChIKey | FCQJRPGFDVBJQC-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|