C31H26ClF2NO3S — CID 169279860
(3-chloro-4-isothiocyanatophenyl) 4-[2-(6-butyl-1,3-difluoro-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]-2-methoxybenzoate (PubChem CID 169279860) has the molecular formula C31H26ClF2NO3S and a molecular weight of 566.07 g/mol. Its IUPAC name is (3-chloro-4-isothiocyanatophenyl) 4-[2-(6-butyl-1,3-difluoro-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]-2-methoxybenzoate.
| Compound Name | (3-chloro-4-isothiocyanatophenyl) 4-[2-(6-butyl-1,3-difluoro-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 169279860 |
| Molecular Formula | C31H26ClF2NO3S |
| Molecular Weight | 566.07 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | (3-chloro-4-isothiocyanatophenyl) 4-[2-(6-butyl-1,3-difluoro-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]-2-methoxybenzoate |
| SMILES | CCCCC1CCc2c(cc(F)c(C#Cc3ccc(C(=O)Oc4ccc(N=C=S)c(Cl)c4)c(OC)c3)c2F)C1 |
| InChI | InChI=1S/C31H26ClF2NO3S/c1-3-4-5-19-6-10-23-21(14-19)16-27(33)24(30(23)34)11-7-20-8-12-25(29(15-20)37-2)31(36)38-22-9-13-28(35-18-39)26(32)17-22/h8-9,12-13,15-17,19H,3-6,10,14H2,1-2H3 |
| InChIKey | GWYICLNRPBWQIF-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.07 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|