C32H27F2NS — CID 169279798
6-[2-[2-ethyl-4-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]phenyl]ethynyl]-5-fluoro-2-propyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 169279798) has the molecular formula C32H27F2NS and a molecular weight of 495.64 g/mol. Its IUPAC name is 6-[2-[2-ethyl-4-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]phenyl]ethynyl]-5-fluoro-2-propyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[2-[2-ethyl-4-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]phenyl]ethynyl]-5-fluoro-2-propyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 169279798 |
| Molecular Formula | C32H27F2NS |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 6-[2-[2-ethyl-4-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]phenyl]ethynyl]-5-fluoro-2-propyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCC1CCc2c(ccc(C#Cc3ccc(C#Cc4ccc(N=C=S)c(F)c4)cc3CC)c2F)C1 |
| InChI | InChI=1S/C32H27F2NS/c1-3-5-22-9-16-29-28(19-22)15-14-27(32(29)34)13-12-26-11-8-23(18-25(26)4-2)6-7-24-10-17-31(35-21-36)30(33)20-24/h8,10-11,14-15,17-18,20,22H,3-5,9,16,19H2,1-2H3 |
| InChIKey | RXIIBGCXLWJWGC-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|