C32H26F3NS — CID 169279853
2-butyl-5,7-difluoro-6-[2-[4-[2-(3-fluoro-4-isothiocyanato-2-methylphenyl)ethynyl]phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 169279853) has the molecular formula C32H26F3NS and a molecular weight of 513.63 g/mol. Its IUPAC name is 2-butyl-5,7-difluoro-6-[2-[4-[2-(3-fluoro-4-isothiocyanato-2-methylphenyl)ethynyl]phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-butyl-5,7-difluoro-6-[2-[4-[2-(3-fluoro-4-isothiocyanato-2-methylphenyl)ethynyl]phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 169279853 |
| Molecular Formula | C32H26F3NS |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 2-butyl-5,7-difluoro-6-[2-[4-[2-(3-fluoro-4-isothiocyanato-2-methylphenyl)ethynyl]phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCC1CCc2c(cc(F)c(C#Cc3ccc(C#Cc4ccc(N=C=S)c(F)c4C)cc3)c2F)C1 |
| InChI | InChI=1S/C32H26F3NS/c1-3-4-5-24-12-15-27-26(18-24)19-29(33)28(32(27)35)16-11-23-8-6-22(7-9-23)10-13-25-14-17-30(36-20-37)31(34)21(25)2/h6-9,14,17,19,24H,3-5,12,15,18H2,1-2H3 |
| InChIKey | IAOQZNQVJZNYDB-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|