C39H35F2NS — CID 169279765
2-butyl-6-[2-[4-[4-[(E)-2-(2-ethyl-4-isothiocyanatophenyl)ethenyl]phenyl]phenyl]ethynyl]-5,7-difluoro-1,2,3,4-tetrahydronaphthalene (PubChem CID 169279765) has the molecular formula C39H35F2NS and a molecular weight of 587.78 g/mol. Its IUPAC name is 2-butyl-6-[2-[4-[4-[(E)-2-(2-ethyl-4-isothiocyanatophenyl)ethenyl]phenyl]phenyl]ethynyl]-5,7-difluoro-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-butyl-6-[2-[4-[4-[(E)-2-(2-ethyl-4-isothiocyanatophenyl)ethenyl]phenyl]phenyl]ethynyl]-5,7-difluoro-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 169279765 |
| Molecular Formula | C39H35F2NS |
| Molecular Weight | 587.78 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | 2-butyl-6-[2-[4-[4-[(E)-2-(2-ethyl-4-isothiocyanatophenyl)ethenyl]phenyl]phenyl]ethynyl]-5,7-difluoro-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCC1CCc2c(cc(F)c(C#Cc3ccc(-c4ccc(/C=C/c5ccc(N=C=S)cc5CC)cc4)cc3)c2F)C1 |
| InChI | InChI=1S/C39H35F2NS/c1-3-5-6-29-13-21-36-34(23-29)25-38(40)37(39(36)41)22-12-28-10-17-33(18-11-28)32-15-8-27(9-16-32)7-14-31-19-20-35(42-26-43)24-30(31)4-2/h7-11,14-20,24-25,29H,3-6,13,21,23H2,1-2H3/b14-7+ |
| InChIKey | BUBSLUYEAWOTNC-VGOFMYFVSA-N |
| XLogP | 10.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.78 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|