C36H29F4NS — CID 169279815
2-butyl-6-[2-[4-[3,5-difluoro-4-(3-fluoro-4-isothiocyanatophenyl)phenyl]-3-fluorophenyl]ethynyl]-5-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 169279815) has the molecular formula C36H29F4NS and a molecular weight of 583.69 g/mol. Its IUPAC name is 2-butyl-6-[2-[4-[3,5-difluoro-4-(3-fluoro-4-isothiocyanatophenyl)phenyl]-3-fluorophenyl]ethynyl]-5-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-butyl-6-[2-[4-[3,5-difluoro-4-(3-fluoro-4-isothiocyanatophenyl)phenyl]-3-fluorophenyl]ethynyl]-5-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 169279815 |
| Molecular Formula | C36H29F4NS |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | 2-butyl-6-[2-[4-[3,5-difluoro-4-(3-fluoro-4-isothiocyanatophenyl)phenyl]-3-fluorophenyl]ethynyl]-5-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCC1CCc2c(ccc(C#Cc3ccc(-c4cc(F)c(-c5ccc(N=C=S)c(F)c5)c(F)c4)c(F)c3)c2C)C1 |
| InChI | InChI=1S/C36H29F4NS/c1-3-4-5-23-7-13-29-22(2)25(10-11-26(29)16-23)9-6-24-8-14-30(31(37)17-24)28-19-33(39)36(34(40)20-28)27-12-15-35(41-21-42)32(38)18-27/h8,10-12,14-15,17-20,23H,3-5,7,13,16H2,1-2H3 |
| InChIKey | YHVDHJQPBLRDDD-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|