C18H12FNS2 — CID 178054453
2-(cyclopenten-1-yl)-5-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]thiophene (PubChem CID 178054453) has the molecular formula C18H12FNS2 and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-5-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]thiophene.
| Compound Name | 2-(cyclopenten-1-yl)-5-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]thiophene |
|---|---|
| PubChem CID | 178054453 |
| Molecular Formula | C18H12FNS2 |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 2-(cyclopenten-1-yl)-5-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]thiophene |
| SMILES | Fc1cc(C#Cc2ccc(C3=CCCC3)s2)ccc1N=C=S |
| InChI | InChI=1S/C18H12FNS2/c19-16-11-13(6-9-17(16)20-12-21)5-7-15-8-10-18(22-15)14-3-1-2-4-14/h3,6,8-11H,1-2,4H2 |
| InChIKey | OCFPSQITRWKHRT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|