C19H15NS2 — CID 178054302
2-(cyclopenten-1-yl)-5-[2-(4-isothiocyanato-3-methylphenyl)ethynyl]thiophene (PubChem CID 178054302) has the molecular formula C19H15NS2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-5-[2-(4-isothiocyanato-3-methylphenyl)ethynyl]thiophene.
| Compound Name | 2-(cyclopenten-1-yl)-5-[2-(4-isothiocyanato-3-methylphenyl)ethynyl]thiophene |
|---|---|
| PubChem CID | 178054302 |
| Molecular Formula | C19H15NS2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-(cyclopenten-1-yl)-5-[2-(4-isothiocyanato-3-methylphenyl)ethynyl]thiophene |
| SMILES | Cc1cc(C#Cc2ccc(C3=CCCC3)s2)ccc1N=C=S |
| InChI | InChI=1S/C19H15NS2/c1-14-12-15(7-10-18(14)20-13-21)6-8-17-9-11-19(22-17)16-4-2-3-5-16/h4,7,9-12H,2-3,5H2,1H3 |
| InChIKey | HIJROBJCLLEZQG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|