C20H13F2NS3 — CID 178054533
2-(cyclopenten-1-yl)-5-[5-(3,5-difluoro-4-isothiocyanatophenyl)thiophen-2-yl]thiophene (PubChem CID 178054533) has the molecular formula C20H13F2NS3 and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-5-[5-(3,5-difluoro-4-isothiocyanatophenyl)thiophen-2-yl]thiophene.
| Compound Name | 2-(cyclopenten-1-yl)-5-[5-(3,5-difluoro-4-isothiocyanatophenyl)thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 178054533 |
| Molecular Formula | C20H13F2NS3 |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 2-(cyclopenten-1-yl)-5-[5-(3,5-difluoro-4-isothiocyanatophenyl)thiophen-2-yl]thiophene |
| SMILES | Fc1cc(-c2ccc(-c3ccc(C4=CCCC4)s3)s2)cc(F)c1N=C=S |
| InChI | InChI=1S/C20H13F2NS3/c21-14-9-13(10-15(22)20(14)23-11-24)17-6-8-19(26-17)18-7-5-16(25-18)12-3-1-2-4-12/h3,5-10H,1-2,4H2 |
| InChIKey | CQADOYNZEHADPZ-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|