C18H11F2NS2 — CID 178054294
2-(cyclopenten-1-yl)-5-[2-(2,6-difluoro-4-isothiocyanatophenyl)ethynyl]thiophene (PubChem CID 178054294) has the molecular formula C18H11F2NS2 and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-5-[2-(2,6-difluoro-4-isothiocyanatophenyl)ethynyl]thiophene.
| Compound Name | 2-(cyclopenten-1-yl)-5-[2-(2,6-difluoro-4-isothiocyanatophenyl)ethynyl]thiophene |
|---|---|
| PubChem CID | 178054294 |
| Molecular Formula | C18H11F2NS2 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 2-(cyclopenten-1-yl)-5-[2-(2,6-difluoro-4-isothiocyanatophenyl)ethynyl]thiophene |
| SMILES | Fc1cc(N=C=S)cc(F)c1C#Cc1ccc(C2=CCCC2)s1 |
| InChI | InChI=1S/C18H11F2NS2/c19-16-9-13(21-11-22)10-17(20)15(16)7-5-14-6-8-18(23-14)12-3-1-2-4-12/h3,6,8-10H,1-2,4H2 |
| InChIKey | IWSUOXNLAWNCBQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|