C15H10F2NRuS — CID 163272970
2-[2-(cyclohexen-1-yl)ethynyl]-1,3-difluoro-5-isothiocyanatobenzene;ruthenium(1+) (PubChem CID 163272970) has the molecular formula C15H10F2NRuS and a molecular weight of 375.39 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethynyl]-1,3-difluoro-5-isothiocyanatobenzene;ruthenium(1+).
| Compound Name | 2-[2-(cyclohexen-1-yl)ethynyl]-1,3-difluoro-5-isothiocyanatobenzene;ruthenium(1+) |
|---|---|
| PubChem CID | 163272970 |
| Molecular Formula | C15H10F2NRuS |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethynyl]-1,3-difluoro-5-isothiocyanatobenzene;ruthenium(1+) |
| SMILES | Fc1cc(N=C=S)cc(F)c1C#CC1=CC[CH-]CC1.[Ru+] |
| InChI | InChI=1S/C15H10F2NS.Ru/c16-14-8-12(18-10-19)9-15(17)13(14)7-6-11-4-2-1-3-5-11;/h1,4,8-9H,2-3,5H2;/q-1;+1 |
| InChIKey | IWMACAWWAJQZGJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|