C19H10F2NRuS — CID 163272912
1,3-difluoro-5-isothiocyanato-2-(4-phenylphenyl)benzene;ruthenium(1+) (PubChem CID 163272912) has the molecular formula C19H10F2NRuS and a molecular weight of 423.43 g/mol. Its IUPAC name is 1,3-difluoro-5-isothiocyanato-2-(4-phenylphenyl)benzene;ruthenium(1+).
| Compound Name | 1,3-difluoro-5-isothiocyanato-2-(4-phenylphenyl)benzene;ruthenium(1+) |
|---|---|
| PubChem CID | 163272912 |
| Molecular Formula | C19H10F2NRuS |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.95 |
| IUPAC Name | 1,3-difluoro-5-isothiocyanato-2-(4-phenylphenyl)benzene;ruthenium(1+) |
| SMILES | Fc1cc(N=C=S)cc(F)c1-c1ccc(-c2cc[c-]cc2)cc1.[Ru+] |
| InChI | InChI=1S/C19H10F2NS.Ru/c20-17-10-16(22-12-23)11-18(21)19(17)15-8-6-14(7-9-15)13-4-2-1-3-5-13;/h2-11H;/q-1;+1 |
| InChIKey | ZZFVFKSZPACWKX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|