C21H19F2NS — CID 163272857
2-[4-(4-ethenylcyclohexyl)phenyl]-1,3-difluoro-5-isothiocyanatobenzene (PubChem CID 163272857) has the molecular formula C21H19F2NS and a molecular weight of 355.45 g/mol. Its IUPAC name is 2-[4-(4-ethenylcyclohexyl)phenyl]-1,3-difluoro-5-isothiocyanatobenzene.
| Compound Name | 2-[4-(4-ethenylcyclohexyl)phenyl]-1,3-difluoro-5-isothiocyanatobenzene |
|---|---|
| PubChem CID | 163272857 |
| Molecular Formula | C21H19F2NS |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-[4-(4-ethenylcyclohexyl)phenyl]-1,3-difluoro-5-isothiocyanatobenzene |
| SMILES | C=CC1CCC(c2ccc(-c3c(F)cc(N=C=S)cc3F)cc2)CC1 |
| InChI | InChI=1S/C21H19F2NS/c1-2-14-3-5-15(6-4-14)16-7-9-17(10-8-16)21-19(22)11-18(24-13-25)12-20(21)23/h2,7-12,14-15H,1,3-6H2 |
| InChIKey | XLCDJRLDXXWOMQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|