C23H25F2NS — CID 163272948
2-[4-(4-butylcyclohexyl)phenyl]-1,3-difluoro-5-isothiocyanatobenzene (PubChem CID 163272948) has the molecular formula C23H25F2NS and a molecular weight of 385.52 g/mol. Its IUPAC name is 2-[4-(4-butylcyclohexyl)phenyl]-1,3-difluoro-5-isothiocyanatobenzene.
| Compound Name | 2-[4-(4-butylcyclohexyl)phenyl]-1,3-difluoro-5-isothiocyanatobenzene |
|---|---|
| PubChem CID | 163272948 |
| Molecular Formula | C23H25F2NS |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-[4-(4-butylcyclohexyl)phenyl]-1,3-difluoro-5-isothiocyanatobenzene |
| SMILES | CCCCC1CCC(c2ccc(-c3c(F)cc(N=C=S)cc3F)cc2)CC1 |
| InChI | InChI=1S/C23H25F2NS/c1-2-3-4-16-5-7-17(8-6-16)18-9-11-19(12-10-18)23-21(24)13-20(26-15-27)14-22(23)25/h9-14,16-17H,2-8H2,1H3 |
| InChIKey | QRWMKDSYCZUWBH-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|