C22H21F4NS — CID 156643590
1,2,4,5-tetrafluoro-3-isothiocyanato-6-[4-(4-propylcyclohexyl)phenyl]benzene (PubChem CID 156643590) has the molecular formula C22H21F4NS and a molecular weight of 407.48 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-isothiocyanato-6-[4-(4-propylcyclohexyl)phenyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-isothiocyanato-6-[4-(4-propylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 156643590 |
| Molecular Formula | C22H21F4NS |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-isothiocyanato-6-[4-(4-propylcyclohexyl)phenyl]benzene |
| SMILES | CCCC1CCC(c2ccc(-c3c(F)c(F)c(N=C=S)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C22H21F4NS/c1-2-3-13-4-6-14(7-5-13)15-8-10-16(11-9-15)17-18(23)20(25)22(27-12-28)21(26)19(17)24/h8-11,13-14H,2-7H2,1H3 |
| InChIKey | BLQQGLJAEYVRLW-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|