C28H29F4NS — CID 165166518
1-[2-[2-ethyl-4-(4-pentylcyclohexyl)phenyl]ethynyl]-2,3,5,6-tetrafluoro-4-isothiocyanatobenzene (PubChem CID 165166518) has the molecular formula C28H29F4NS and a molecular weight of 487.61 g/mol. Its IUPAC name is 1-[2-[2-ethyl-4-(4-pentylcyclohexyl)phenyl]ethynyl]-2,3,5,6-tetrafluoro-4-isothiocyanatobenzene.
| Compound Name | 1-[2-[2-ethyl-4-(4-pentylcyclohexyl)phenyl]ethynyl]-2,3,5,6-tetrafluoro-4-isothiocyanatobenzene |
|---|---|
| PubChem CID | 165166518 |
| Molecular Formula | C28H29F4NS |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 1-[2-[2-ethyl-4-(4-pentylcyclohexyl)phenyl]ethynyl]-2,3,5,6-tetrafluoro-4-isothiocyanatobenzene |
| SMILES | CCCCCC1CCC(c2ccc(C#Cc3c(F)c(F)c(N=C=S)c(F)c3F)c(CC)c2)CC1 |
| InChI | InChI=1S/C28H29F4NS/c1-3-5-6-7-18-8-10-21(11-9-18)22-13-12-20(19(4-2)16-22)14-15-23-24(29)26(31)28(33-17-34)27(32)25(23)30/h12-13,16,18,21H,3-11H2,1-2H3 |
| InChIKey | XNCANQUFMCIQPP-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|