C24H21F2NS — CID 163272910
1,3-difluoro-5-isothiocyanato-2-[4-(4-pentylphenyl)phenyl]benzene (PubChem CID 163272910) has the molecular formula C24H21F2NS and a molecular weight of 393.50 g/mol. Its IUPAC name is 1,3-difluoro-5-isothiocyanato-2-[4-(4-pentylphenyl)phenyl]benzene.
| Compound Name | 1,3-difluoro-5-isothiocyanato-2-[4-(4-pentylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 163272910 |
| Molecular Formula | C24H21F2NS |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1,3-difluoro-5-isothiocyanato-2-[4-(4-pentylphenyl)phenyl]benzene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3c(F)cc(N=C=S)cc3F)cc2)cc1 |
| InChI | InChI=1S/C24H21F2NS/c1-2-3-4-5-17-6-8-18(9-7-17)19-10-12-20(13-11-19)24-22(25)14-21(27-16-28)15-23(24)26/h6-15H,2-5H2,1H3 |
| InChIKey | KURKROVCUJPYII-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|