C23H21F2NS2 — CID 178054517
2-[3,5-difluoro-4-(4-isothiocyanatophenyl)phenyl]-5-hexylthiophene (PubChem CID 178054517) has the molecular formula C23H21F2NS2 and a molecular weight of 413.56 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(4-isothiocyanatophenyl)phenyl]-5-hexylthiophene.
| Compound Name | 2-[3,5-difluoro-4-(4-isothiocyanatophenyl)phenyl]-5-hexylthiophene |
|---|---|
| PubChem CID | 178054517 |
| Molecular Formula | C23H21F2NS2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 2-[3,5-difluoro-4-(4-isothiocyanatophenyl)phenyl]-5-hexylthiophene |
| SMILES | CCCCCCc1ccc(-c2cc(F)c(-c3ccc(N=C=S)cc3)c(F)c2)s1 |
| InChI | InChI=1S/C23H21F2NS2/c1-2-3-4-5-6-19-11-12-22(28-19)17-13-20(24)23(21(25)14-17)16-7-9-18(10-8-16)26-15-27/h7-14H,2-6H2,1H3 |
| InChIKey | AYCTWFPKMZROIX-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|