C26H31FS — CID 170655021
2-[2-fluoro-4-(4-pentylphenyl)phenyl]-5-pentylthiophene (PubChem CID 170655021) has the molecular formula C26H31FS and a molecular weight of 394.60 g/mol. Its IUPAC name is 2-[2-fluoro-4-(4-pentylphenyl)phenyl]-5-pentylthiophene.
| Compound Name | 2-[2-fluoro-4-(4-pentylphenyl)phenyl]-5-pentylthiophene |
|---|---|
| PubChem CID | 170655021 |
| Molecular Formula | C26H31FS |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 2-[2-fluoro-4-(4-pentylphenyl)phenyl]-5-pentylthiophene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(CCCCC)s3)c(F)c2)cc1 |
| InChI | InChI=1S/C26H31FS/c1-3-5-7-9-20-11-13-21(14-12-20)22-15-17-24(25(27)19-22)26-18-16-23(28-26)10-8-6-4-2/h11-19H,3-10H2,1-2H3 |
| InChIKey | FFFDOYSIAOSAPC-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|