C23H23FS — CID 166999874
2-(2-cyclopropylethyl)-5-[4-(4-ethylphenyl)-2-fluorophenyl]thiophene (PubChem CID 166999874) has the molecular formula C23H23FS and a molecular weight of 350.50 g/mol. Its IUPAC name is 2-(2-cyclopropylethyl)-5-[4-(4-ethylphenyl)-2-fluorophenyl]thiophene.
| Compound Name | 2-(2-cyclopropylethyl)-5-[4-(4-ethylphenyl)-2-fluorophenyl]thiophene |
|---|---|
| PubChem CID | 166999874 |
| Molecular Formula | C23H23FS |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-(2-cyclopropylethyl)-5-[4-(4-ethylphenyl)-2-fluorophenyl]thiophene |
| SMILES | CCc1ccc(-c2ccc(-c3ccc(CCC4CC4)s3)c(F)c2)cc1 |
| InChI | InChI=1S/C23H23FS/c1-2-16-5-8-18(9-6-16)19-10-13-21(22(24)15-19)23-14-12-20(25-23)11-7-17-3-4-17/h5-6,8-10,12-15,17H,2-4,7,11H2,1H3 |
| InChIKey | DKSQKOGBOJJGFL-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |