C26H29FOS — CID 166999870
2-[4-(4-ethylphenyl)-2-fluorophenyl]-5-(3-propylcyclopentyl)oxythiophene (PubChem CID 166999870) has the molecular formula C26H29FOS and a molecular weight of 408.58 g/mol. Its IUPAC name is 2-[4-(4-ethylphenyl)-2-fluorophenyl]-5-(3-propylcyclopentyl)oxythiophene.
| Compound Name | 2-[4-(4-ethylphenyl)-2-fluorophenyl]-5-(3-propylcyclopentyl)oxythiophene |
|---|---|
| PubChem CID | 166999870 |
| Molecular Formula | C26H29FOS |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2-[4-(4-ethylphenyl)-2-fluorophenyl]-5-(3-propylcyclopentyl)oxythiophene |
| SMILES | CCCC1CCC(Oc2ccc(-c3ccc(-c4ccc(CC)cc4)cc3F)s2)C1 |
| InChI | InChI=1S/C26H29FOS/c1-3-5-19-8-12-22(16-19)28-26-15-14-25(29-26)23-13-11-21(17-24(23)27)20-9-6-18(4-2)7-10-20/h6-7,9-11,13-15,17,19,22H,3-5,8,12,16H2,1-2H3 |
| InChIKey | YEAYAMHYGLZPLV-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |