C19H16F2S — CID 58160698
2-fluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]thiophene (PubChem CID 58160698) has the molecular formula C19H16F2S and a molecular weight of 314.40 g/mol. Its IUPAC name is 2-fluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]thiophene.
| Compound Name | 2-fluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]thiophene |
|---|---|
| PubChem CID | 58160698 |
| Molecular Formula | C19H16F2S |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-fluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]thiophene |
| SMILES | CCCc1ccc(-c2ccc(-c3ccc(F)s3)c(F)c2)cc1 |
| InChI | InChI=1S/C19H16F2S/c1-2-3-13-4-6-14(7-5-13)15-8-9-16(17(20)12-15)18-10-11-19(21)22-18/h4-12H,2-3H2,1H3 |
| InChIKey | KYMQTFGBDMZXJP-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |