C18H15FS — CID 143775701
2-[4-(4-ethylphenyl)-2-fluorophenyl]thiophene (PubChem CID 143775701) has the molecular formula C18H15FS and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-[4-(4-ethylphenyl)-2-fluorophenyl]thiophene.
| Compound Name | 2-[4-(4-ethylphenyl)-2-fluorophenyl]thiophene |
|---|---|
| PubChem CID | 143775701 |
| Molecular Formula | C18H15FS |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-[4-(4-ethylphenyl)-2-fluorophenyl]thiophene |
| SMILES | CCc1ccc(-c2ccc(-c3cccs3)c(F)c2)cc1 |
| InChI | InChI=1S/C18H15FS/c1-2-13-5-7-14(8-6-13)15-9-10-16(17(19)12-15)18-4-3-11-20-18/h3-12H,2H2,1H3 |
| InChIKey | FIAKXMCTJSFAIY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |