C22H17F — CID 140891747
4-(4-ethylphenyl)-1-(4-ethynylphenyl)-2-fluorobenzene (PubChem CID 140891747) has the molecular formula C22H17F and a molecular weight of 300.38 g/mol. Its IUPAC name is 4-(4-ethylphenyl)-1-(4-ethynylphenyl)-2-fluorobenzene.
| Compound Name | 4-(4-ethylphenyl)-1-(4-ethynylphenyl)-2-fluorobenzene |
|---|---|
| PubChem CID | 140891747 |
| Molecular Formula | C22H17F |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-(4-ethylphenyl)-1-(4-ethynylphenyl)-2-fluorobenzene |
| SMILES | C#Cc1ccc(-c2ccc(-c3ccc(CC)cc3)cc2F)cc1 |
| InChI | InChI=1S/C22H17F/c1-3-16-5-9-18(10-6-16)20-13-14-21(22(23)15-20)19-11-7-17(4-2)8-12-19/h2,5-15H,3H2,1H3 |
| InChIKey | PVNYIZVNPRRJTK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|