C23H21FOS — CID 177128982
2-[4-(4-cyclopent-3-en-1-yloxyphenyl)-2-fluorophenyl]-5-ethylthiophene (PubChem CID 177128982) has the molecular formula C23H21FOS and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[4-(4-cyclopent-3-en-1-yloxyphenyl)-2-fluorophenyl]-5-ethylthiophene.
| Compound Name | 2-[4-(4-cyclopent-3-en-1-yloxyphenyl)-2-fluorophenyl]-5-ethylthiophene |
|---|---|
| PubChem CID | 177128982 |
| Molecular Formula | C23H21FOS |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-[4-(4-cyclopent-3-en-1-yloxyphenyl)-2-fluorophenyl]-5-ethylthiophene |
| SMILES | CCc1ccc(-c2ccc(-c3ccc(OC4CC=CC4)cc3)cc2F)s1 |
| InChI | InChI=1S/C23H21FOS/c1-2-20-12-14-23(26-20)21-13-9-17(15-22(21)24)16-7-10-19(11-8-16)25-18-5-3-4-6-18/h3-4,7-15,18H,2,5-6H2,1H3 |
| InChIKey | GXXGEZURZHVFQL-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|