C20H17FS — CID 170655035
2-[4-(4-cyclopropylphenyl)-2-fluorophenyl]-5-methylthiophene (PubChem CID 170655035) has the molecular formula C20H17FS and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-[4-(4-cyclopropylphenyl)-2-fluorophenyl]-5-methylthiophene.
| Compound Name | 2-[4-(4-cyclopropylphenyl)-2-fluorophenyl]-5-methylthiophene |
|---|---|
| PubChem CID | 170655035 |
| Molecular Formula | C20H17FS |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-[4-(4-cyclopropylphenyl)-2-fluorophenyl]-5-methylthiophene |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(C4CC4)cc3)cc2F)s1 |
| InChI | InChI=1S/C20H17FS/c1-13-2-11-20(22-13)18-10-9-17(12-19(18)21)16-7-5-15(6-8-16)14-3-4-14/h2,5-12,14H,3-4H2,1H3 |
| InChIKey | OTQIOQINLAHWIL-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |