C20H22F — CID 59940195
CID 59940195 (PubChem CID 59940195) has the molecular formula C20H22F and a molecular weight of 281.39 g/mol.
| Compound Name | CID 59940195 |
|---|---|
| PubChem CID | 59940195 |
| Molecular Formula | C20H22F |
| Molecular Weight | 281.39 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | — |
| SMILES | C[C]1CCC(c2ccc(-c3ccc(C)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C20H22F/c1-14-3-6-16(7-4-14)17-9-11-18(12-10-17)19-8-5-15(2)20(21)13-19/h5,8-13,16H,3-4,6-7H2,1-2H3 |
| InChIKey | JQQRALQRAHCXSN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |