C19H20F2Si — CID 19601961
CID 19601961 (PubChem CID 19601961) has the molecular formula C19H20F2Si and a molecular weight of 314.45 g/mol.
| Compound Name | CID 19601961 |
|---|---|
| PubChem CID | 19601961 |
| Molecular Formula | C19H20F2Si |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | — |
| SMILES | C[Si]C1CCC(c2ccc(-c3ccc(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C19H20F2Si/c1-22-17-9-6-14(7-10-17)13-2-4-15(5-3-13)16-8-11-18(20)19(21)12-16/h2-5,8,11-12,14,17H,6-7,9-10H2,1H3 |
| InChIKey | HRUYLKLWQGJBNF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|