C20H24F2Si — CID 22875775
4-[4-(3,4-difluorophenyl)phenyl]-1-propylsilinane (PubChem CID 22875775) has the molecular formula C20H24F2Si and a molecular weight of 330.49 g/mol. Its IUPAC name is 4-[4-(3,4-difluorophenyl)phenyl]-1-propylsilinane.
| Compound Name | 4-[4-(3,4-difluorophenyl)phenyl]-1-propylsilinane |
|---|---|
| PubChem CID | 22875775 |
| Molecular Formula | C20H24F2Si |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-[4-(3,4-difluorophenyl)phenyl]-1-propylsilinane |
| SMILES | CCC[SiH]1CCC(c2ccc(-c3ccc(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C20H24F2Si/c1-2-11-23-12-9-17(10-13-23)15-3-5-16(6-4-15)18-7-8-19(21)20(22)14-18/h3-8,14,17,23H,2,9-13H2,1H3 |
| InChIKey | VKVZSAJFIGREHY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|