C30H36F2Si — CID 54735607
4-[4-[2-[4-(3,4-difluorophenyl)phenyl]ethyl]phenyl]-1-pentylsilinane (PubChem CID 54735607) has the molecular formula C30H36F2Si and a molecular weight of 462.70 g/mol. Its IUPAC name is 4-[4-[2-[4-(3,4-difluorophenyl)phenyl]ethyl]phenyl]-1-pentylsilinane.
| Compound Name | 4-[4-[2-[4-(3,4-difluorophenyl)phenyl]ethyl]phenyl]-1-pentylsilinane |
|---|---|
| PubChem CID | 54735607 |
| Molecular Formula | C30H36F2Si |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 4-[4-[2-[4-(3,4-difluorophenyl)phenyl]ethyl]phenyl]-1-pentylsilinane |
| SMILES | CCCCC[SiH]1CCC(c2ccc(CCc3ccc(-c4ccc(F)c(F)c4)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H36F2Si/c1-2-3-4-19-33-20-17-27(18-21-33)25-11-7-23(8-12-25)5-6-24-9-13-26(14-10-24)28-15-16-29(31)30(32)22-28/h7-16,22,27,33H,2-6,17-21H2,1H3 |
| InChIKey | FSKLTJRWFQRVGQ-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|