C20H23FO2 — CID 144809360
2-fluoro-1-methoxy-4-[4-(4-methoxycyclohexyl)phenyl]benzene (PubChem CID 144809360) has the molecular formula C20H23FO2 and a molecular weight of 314.40 g/mol. Its IUPAC name is 2-fluoro-1-methoxy-4-[4-(4-methoxycyclohexyl)phenyl]benzene.
| Compound Name | 2-fluoro-1-methoxy-4-[4-(4-methoxycyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 144809360 |
| Molecular Formula | C20H23FO2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-fluoro-1-methoxy-4-[4-(4-methoxycyclohexyl)phenyl]benzene |
| SMILES | COc1ccc(-c2ccc(C3CCC(OC)CC3)cc2)cc1F |
| InChI | InChI=1S/C20H23FO2/c1-22-18-10-7-15(8-11-18)14-3-5-16(6-4-14)17-9-12-20(23-2)19(21)13-17/h3-6,9,12-13,15,18H,7-8,10-11H2,1-2H3 |
| InChIKey | BLINCRZXJQZKSQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |